About 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid
2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid (PubChem CID 18069956) has the molecular formula C8H11N3O6S
and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid |
| PubChem CID | 18069956 |
| Molecular Formula | C8H11N3O6S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid |
| SMILES | Cn1cc(S(=O)(=O)NCC(=O)O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H11N3O6S/c1-10-4-5(7(14)11(2)8(10)15)18(16,17)9-3-6(12)13/h4,9H,3H2,1-2H3,(H,12,13) |
| InChIKey | APOPIZUZAGVIGJ-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid?
The IUPAC name of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid (CID 18069956) is 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid.
What is the SMILES notation for 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid?
The canonical SMILES for 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid is Cn1cc(S(=O)(=O)NCC(=O)O)c(=O)n(C)c1=O.
What is the InChIKey of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid?
The InChIKey is APOPIZUZAGVIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O6S/c1-10-4-5(7(14)11(2)8(10)15)18(16,17)9-3-6(12)13/h4,9H,3H2,1-2H3,(H,12,13).
What are the key properties of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid?
2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid has a molecular weight of 277.26 g/mol, XLogP of -2.55, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]acetic acid is sourced from PubChem (CID 18069956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).