About 2,3,6-trichloroquinoxaline
2,3,6-trichloroquinoxaline (PubChem CID 18070) has the molecular formula C8H3Cl3N2
and a molecular weight of 233.49 g/mol. Its IUPAC name is 2,3,6-trichloroquinoxaline.
Molecular Properties
| Compound Name | 2,3,6-trichloroquinoxaline |
| PubChem CID | 18070 |
| Molecular Formula | C8H3Cl3N2 |
| Molecular Weight | 233.49 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 2,3,6-trichloroquinoxaline |
| SMILES | Clc1ccc2nc(Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C8H3Cl3N2/c9-4-1-2-5-6(3-4)13-8(11)7(10)12-5/h1-3H |
| InChIKey | GZEGFNCRZUGIOB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,6-trichloroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trichloroquinoxaline?
The IUPAC name of 2,3,6-trichloroquinoxaline (CID 18070) is 2,3,6-trichloroquinoxaline.
What is the SMILES notation for 2,3,6-trichloroquinoxaline?
The canonical SMILES for 2,3,6-trichloroquinoxaline is Clc1ccc2nc(Cl)c(Cl)nc2c1.
What is the InChIKey of 2,3,6-trichloroquinoxaline?
The InChIKey is GZEGFNCRZUGIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl3N2/c9-4-1-2-5-6(3-4)13-8(11)7(10)12-5/h1-3H.
What are the key properties of 2,3,6-trichloroquinoxaline?
2,3,6-trichloroquinoxaline has a molecular weight of 233.49 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trichloroquinoxaline is sourced from PubChem (CID 18070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).