About piperidin-2-ylmethylurea
piperidin-2-ylmethylurea (PubChem CID 18070645) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is piperidin-2-ylmethylurea.
Molecular Properties
| Compound Name | piperidin-2-ylmethylurea |
| PubChem CID | 18070645 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | piperidin-2-ylmethylurea |
| SMILES | NC(=O)NCC1CCCCN1 |
| InChI | InChI=1S/C7H15N3O/c8-7(11)10-5-6-3-1-2-4-9-6/h6,9H,1-5H2,(H3,8,10,11) |
| InChIKey | VBTLNWLRGZKILF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidin-2-ylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-2-ylmethylurea?
The IUPAC name of piperidin-2-ylmethylurea (CID 18070645) is piperidin-2-ylmethylurea.
What is the SMILES notation for piperidin-2-ylmethylurea?
The canonical SMILES for piperidin-2-ylmethylurea is NC(=O)NCC1CCCCN1.
What is the InChIKey of piperidin-2-ylmethylurea?
The InChIKey is VBTLNWLRGZKILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c8-7(11)10-5-6-3-1-2-4-9-6/h6,9H,1-5H2,(H3,8,10,11).
What are the key properties of piperidin-2-ylmethylurea?
piperidin-2-ylmethylurea has a molecular weight of 157.22 g/mol, XLogP of -0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-2-ylmethylurea is sourced from PubChem (CID 18070645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).