About 2-cyclopropylpyrrolidine
2-cyclopropylpyrrolidine (PubChem CID 18070899) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is 2-cyclopropylpyrrolidine.
Molecular Properties
| Compound Name | 2-cyclopropylpyrrolidine |
| PubChem CID | 18070899 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 2-cyclopropylpyrrolidine |
| SMILES | C1CNC(C2CC2)C1 |
| InChI | InChI=1S/C7H13N/c1-2-7(8-5-1)6-3-4-6/h6-8H,1-5H2 |
| InChIKey | WOUSTBXLCUPLRA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylpyrrolidine?
The IUPAC name of 2-cyclopropylpyrrolidine (CID 18070899) is 2-cyclopropylpyrrolidine.
What is the SMILES notation for 2-cyclopropylpyrrolidine?
The canonical SMILES for 2-cyclopropylpyrrolidine is C1CNC(C2CC2)C1.
What is the InChIKey of 2-cyclopropylpyrrolidine?
The InChIKey is WOUSTBXLCUPLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-2-7(8-5-1)6-3-4-6/h6-8H,1-5H2.
What are the key properties of 2-cyclopropylpyrrolidine?
2-cyclopropylpyrrolidine has a molecular weight of 111.19 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylpyrrolidine is sourced from PubChem (CID 18070899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).