C11H16N2O2 — CID 18071038
N-(2-aminoethyl)-3-methoxy-4-methylbenzamide (PubChem CID 18071038) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-methoxy-4-methylbenzamide.
| Compound Name | N-(2-aminoethyl)-3-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 18071038 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(2-aminoethyl)-3-methoxy-4-methylbenzamide |
| SMILES | COc1cc(C(=O)NCCN)ccc1C |
| InChI | InChI=1S/C11H16N2O2/c1-8-3-4-9(7-10(8)15-2)11(14)13-6-5-12/h3-4,7H,5-6,12H2,1-2H3,(H,13,14) |
| InChIKey | AZNWRKATGHYVBD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |