About 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole
2-(chloromethyl)-5,6-difluoro-1H-benzimidazole (PubChem CID 18071312) has the molecular formula C8H5ClF2N2
and a molecular weight of 202.59 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole |
| PubChem CID | 18071312 |
| Molecular Formula | C8H5ClF2N2 |
| Molecular Weight | 202.59 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole |
| SMILES | Fc1cc2nc(CCl)[nH]c2cc1F |
| InChI | InChI=1S/C8H5ClF2N2/c9-3-8-12-6-1-4(10)5(11)2-7(6)13-8/h1-2H,3H2,(H,12,13) |
| InChIKey | XKSUDTNRLIXEFE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole?
The IUPAC name of 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole (CID 18071312) is 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole.
What is the SMILES notation for 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole?
The canonical SMILES for 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole is Fc1cc2nc(CCl)[nH]c2cc1F.
What is the InChIKey of 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole?
The InChIKey is XKSUDTNRLIXEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF2N2/c9-3-8-12-6-1-4(10)5(11)2-7(6)13-8/h1-2H,3H2,(H,12,13).
What are the key properties of 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole?
2-(chloromethyl)-5,6-difluoro-1H-benzimidazole has a molecular weight of 202.59 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-5,6-difluoro-1H-benzimidazole is sourced from PubChem (CID 18071312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).