C12H15NO3 — CID 18071913
2-[(2,5-dimethylbenzoyl)-methylamino]acetic acid (PubChem CID 18071913) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[(2,5-dimethylbenzoyl)-methylamino]acetic acid.
| Compound Name | 2-[(2,5-dimethylbenzoyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 18071913 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-[(2,5-dimethylbenzoyl)-methylamino]acetic acid |
| SMILES | Cc1ccc(C)c(C(=O)N(C)CC(=O)O)c1 |
| InChI | InChI=1S/C12H15NO3/c1-8-4-5-9(2)10(6-8)12(16)13(3)7-11(14)15/h4-6H,7H2,1-3H3,(H,14,15) |
| InChIKey | RKGYAOHQVBYMMV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |