methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate

C11H17NO4 — CID 18072004

IUPACmethyl 1-(3-oxobutanoyl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(C(=O)CC(C)=O)CC1
InChIInChI=1S/C11H17NO4/c1-8(13)7-10(14)12-5-3-9(4-6-12)11(15)16-2/h9H,3-7H2,1-2H3
InChIKeyRNJIAZNZYCFTBZ-UHFFFAOYSA-N
MW227.26 g/mol
LogP0.38
Rot. Bonds3

About methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate

methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate (PubChem CID 18072004) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-(3-oxobutanoyl)piperidine-4-carboxylate
PubChem CID18072004
Molecular FormulaC11H17NO4
Molecular Weight227.26 g/mol
Exact Mass227.12
IUPAC Namemethyl 1-(3-oxobutanoyl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(C(=O)CC(C)=O)CC1
InChIInChI=1S/C11H17NO4/c1-8(13)7-10(14)12-5-3-9(4-6-12)11(15)16-2/h9H,3-7H2,1-2H3
InChIKeyRNJIAZNZYCFTBZ-UHFFFAOYSA-N
XLogP0.38
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 50.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate (CID 18072004) is methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate is COC(=O)C1CCN(C(=O)CC(C)=O)CC1.
What is the InChIKey of methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate?
The InChIKey is RNJIAZNZYCFTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-8(13)7-10(14)12-5-3-9(4-6-12)11(15)16-2/h9H,3-7H2,1-2H3.
What are the key properties of methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate?
methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate has a molecular weight of 227.26 g/mol, XLogP of 0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3-oxobutanoyl)piperidine-4-carboxylate is sourced from PubChem (CID 18072004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).