C18H14ClNO2 — CID 18073531
2-(4-chlorophenyl)-6,7-dimethylquinoline-4-carboxylic acid (PubChem CID 18073531) has the molecular formula C18H14ClNO2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,7-dimethylquinoline-4-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-6,7-dimethylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 18073531 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(4-chlorophenyl)-6,7-dimethylquinoline-4-carboxylic acid |
| SMILES | Cc1cc2nc(-c3ccc(Cl)cc3)cc(C(=O)O)c2cc1C |
| InChI | InChI=1S/C18H14ClNO2/c1-10-7-14-15(18(21)22)9-16(20-17(14)8-11(10)2)12-3-5-13(19)6-4-12/h3-9H,1-2H3,(H,21,22) |
| InChIKey | IIIRZNPZRDQVSW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |