C15H17NO5 — CID 18074027
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 2,6-dimethoxybenzoate (PubChem CID 18074027) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2,6-dimethoxybenzoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 18074027 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCc1c(C)noc1C |
| InChI | InChI=1S/C15H17NO5/c1-9-11(10(2)21-16-9)8-20-15(17)14-12(18-3)6-5-7-13(14)19-4/h5-7H,8H2,1-4H3 |
| InChIKey | CQASDWDKORZXHJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |