C14H15N3O3S — CID 18075073
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,4-dimethoxybenzamide (PubChem CID 18075073) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,4-dimethoxybenzamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18075073 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(C3CC3)s2)c(OC)c1 |
| InChI | InChI=1S/C14H15N3O3S/c1-19-9-5-6-10(11(7-9)20-2)12(18)15-14-17-16-13(21-14)8-3-4-8/h5-8H,3-4H2,1-2H3,(H,15,17,18) |
| InChIKey | NVFYKWQXKUMKDZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |