C19H21N3O4S — CID 18078234
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate (PubChem CID 18078234) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 18078234 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate |
| SMILES | Cc1noc(C)c1COC(=O)c1sc2nc3n(c(=O)c2c1C)CCCCC3 |
| InChI | InChI=1S/C19H21N3O4S/c1-10-15-17(20-14-7-5-4-6-8-22(14)18(15)23)27-16(10)19(24)25-9-13-11(2)21-26-12(13)3/h4-9H2,1-3H3 |
| InChIKey | YEPIQLIPXBPPKQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |