C19H23N3O4 — CID 18079053
[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 18079053) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 18079053 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | CC1CCN(C(=O)C(C)OC(=O)c2nn(C)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C19H23N3O4/c1-12-8-10-22(11-9-12)17(23)13(2)26-19(25)16-14-6-4-5-7-15(14)18(24)21(3)20-16/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | LBELOEBGDSMRHR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |