About 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide
1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide (PubChem CID 18081152) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide |
| PubChem CID | 18081152 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)Nc2ncc(C)s2)ccc1=O |
| InChI | InChI=1S/C13H16N4O2S/c1-3-4-7-17-11(18)6-5-10(16-17)12(19)15-13-14-8-9(2)20-13/h5-6,8H,3-4,7H2,1-2H3,(H,14,15,19) |
| InChIKey | BZKMYWARCJCEKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide?
The IUPAC name of 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide (CID 18081152) is 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide.
What is the SMILES notation for 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide?
The canonical SMILES for 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide is CCCCn1nc(C(=O)Nc2ncc(C)s2)ccc1=O.
What is the InChIKey of 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide?
The InChIKey is BZKMYWARCJCEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-3-4-7-17-11(18)6-5-10(16-17)12(19)15-13-14-8-9(2)20-13/h5-6,8H,3-4,7H2,1-2H3,(H,14,15,19).
What are the key properties of 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide?
1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide has a molecular weight of 292.36 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-N-(5-methyl-1,3-thiazol-2-yl)-6-oxopyridazine-3-carboxamide is sourced from PubChem (CID 18081152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).