About [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate
[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 18082032) has the molecular formula C14H18N4O3S
and a molecular weight of 322.39 g/mol. Its IUPAC name is [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 18082032 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)OCC(=O)Nc2ccnn2C(C)C)s1 |
| InChI | InChI=1S/C14H18N4O3S/c1-8(2)18-11(5-6-15-18)17-12(19)7-21-14(20)13-9(3)16-10(4)22-13/h5-6,8H,7H2,1-4H3,(H,17,19) |
| InChIKey | YMRXUPYLDASNCW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The IUPAC name of [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (CID 18082032) is [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate is Cc1nc(C)c(C(=O)OCC(=O)Nc2ccnn2C(C)C)s1.
What is the InChIKey of [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The InChIKey is YMRXUPYLDASNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3S/c1-8(2)18-11(5-6-15-18)17-12(19)7-21-14(20)13-9(3)16-10(4)22-13/h5-6,8H,7H2,1-4H3,(H,17,19).
What are the key properties of [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate has a molecular weight of 322.39 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 18082032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).