C16H23ClN2O — CID 18083488
N-(3-chlorophenyl)-2-(3,5-dimethylpiperidin-1-yl)propanamide (PubChem CID 18083488) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(3,5-dimethylpiperidin-1-yl)propanamide.
| Compound Name | N-(3-chlorophenyl)-2-(3,5-dimethylpiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 18083488 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-(3-chlorophenyl)-2-(3,5-dimethylpiperidin-1-yl)propanamide |
| SMILES | CC1CC(C)CN(C(C)C(=O)Nc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H23ClN2O/c1-11-7-12(2)10-19(9-11)13(3)16(20)18-15-6-4-5-14(17)8-15/h4-6,8,11-13H,7,9-10H2,1-3H3,(H,18,20) |
| InChIKey | MXNXUGZLEBGSEG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |