About N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide
N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide (PubChem CID 18083837) has the molecular formula C18H20ClFN2O3S
and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide |
| PubChem CID | 18083837 |
| Molecular Formula | C18H20ClFN2O3S |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)N(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H20ClFN2O3S/c1-12-8-9-13(26(24,25)21(2)3)10-14(12)18(23)22(4)11-15-16(19)6-5-7-17(15)20/h5-10H,11H2,1-4H3 |
| InChIKey | PSAVXMOJUCNTMQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide?
The IUPAC name of N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide (CID 18083837) is N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide.
What is the SMILES notation for N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide?
The canonical SMILES for N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide is Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)N(C)Cc1c(F)cccc1Cl.
What is the InChIKey of N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide?
The InChIKey is PSAVXMOJUCNTMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClFN2O3S/c1-12-8-9-13(26(24,25)21(2)3)10-14(12)18(23)22(4)11-15-16(19)6-5-7-17(15)20/h5-10H,11H2,1-4H3.
What are the key properties of N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide?
N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide has a molecular weight of 398.89 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-6-fluorophenyl)methyl]-5-(dimethylsulfamoyl)-N,2-dimethylbenzamide is sourced from PubChem (CID 18083837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).