C19H20N4O5 — CID 18084314
N-[3-(methylcarbamoyl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 18084314) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[3-(methylcarbamoyl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[3-(methylcarbamoyl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 18084314 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[3-(methylcarbamoyl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C19H20N4O5/c1-20-18(24)13-3-2-4-14(11-13)21-19(25)16-12-15(23(26)27)5-6-17(16)22-7-9-28-10-8-22/h2-6,11-12H,7-10H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | FRPRFRRBEIAILY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|