C18H19F2NO — CID 18084334
N-[1-(3,4-difluorophenyl)ethyl]-2-(3,4-dimethylphenyl)acetamide (PubChem CID 18084334) has the molecular formula C18H19F2NO and a molecular weight of 303.35 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2-(3,4-dimethylphenyl)acetamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 18084334 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NC(C)c2ccc(F)c(F)c2)cc1C |
| InChI | InChI=1S/C18H19F2NO/c1-11-4-5-14(8-12(11)2)9-18(22)21-13(3)15-6-7-16(19)17(20)10-15/h4-8,10,13H,9H2,1-3H3,(H,21,22) |
| InChIKey | BESNEWKYYTYVOF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |