C17H17FN2O — CID 18084883
2-(2,3-dihydroindol-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 18084883) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18084883 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CN1CCc2ccccc21 |
| InChI | InChI=1S/C17H17FN2O/c1-12-6-7-14(18)10-15(12)19-17(21)11-20-9-8-13-4-2-3-5-16(13)20/h2-7,10H,8-9,11H2,1H3,(H,19,21) |
| InChIKey | MLVOMHFKGGDSRM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |