C16H15Cl3N2O — CID 18085946
2-[1-(2-chlorophenyl)ethylamino]-N-(2,6-dichlorophenyl)acetamide (PubChem CID 18085946) has the molecular formula C16H15Cl3N2O and a molecular weight of 357.67 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)ethylamino]-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-[1-(2-chlorophenyl)ethylamino]-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 18085946 |
| Molecular Formula | C16H15Cl3N2O |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-[1-(2-chlorophenyl)ethylamino]-N-(2,6-dichlorophenyl)acetamide |
| SMILES | CC(NCC(=O)Nc1c(Cl)cccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C16H15Cl3N2O/c1-10(11-5-2-3-6-12(11)17)20-9-15(22)21-16-13(18)7-4-8-14(16)19/h2-8,10,20H,9H2,1H3,(H,21,22) |
| InChIKey | BZGGKPCBLZMJLI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |