C16H15Cl2FN2O — CID 18086055
N-(2,4-dichlorophenyl)-2-[1-(2-fluorophenyl)ethylamino]acetamide (PubChem CID 18086055) has the molecular formula C16H15Cl2FN2O and a molecular weight of 341.21 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[1-(2-fluorophenyl)ethylamino]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[1-(2-fluorophenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 18086055 |
| Molecular Formula | C16H15Cl2FN2O |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[1-(2-fluorophenyl)ethylamino]acetamide |
| SMILES | CC(NCC(=O)Nc1ccc(Cl)cc1Cl)c1ccccc1F |
| InChI | InChI=1S/C16H15Cl2FN2O/c1-10(12-4-2-3-5-14(12)19)20-9-16(22)21-15-7-6-11(17)8-13(15)18/h2-8,10,20H,9H2,1H3,(H,21,22) |
| InChIKey | JNISNFZGEHWCCG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |