C17H23FN2O4 — CID 18086997
5,5-diethyl-3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]imidazolidine-2,4-dione (PubChem CID 18086997) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is 5,5-diethyl-3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18086997 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5,5-diethyl-3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(O)COCc2ccccc2F)C1=O |
| InChI | InChI=1S/C17H23FN2O4/c1-3-17(4-2)15(22)20(16(23)19-17)9-13(21)11-24-10-12-7-5-6-8-14(12)18/h5-8,13,21H,3-4,9-11H2,1-2H3,(H,19,23) |
| InChIKey | BZBSYXIOBWOYOC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|