C18H23NO5 — CID 18091504
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 18091504) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 18091504 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | C=CCNC(=O)C(C)OC(=O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H23NO5/c1-3-10-19-17(20)13(2)24-18(21)14-6-8-15(9-7-14)23-12-16-5-4-11-22-16/h3,6-9,13,16H,1,4-5,10-12H2,2H3,(H,19,20) |
| InChIKey | OWHWLYFZCOFVMI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|