C17H15BrClNO5 — CID 18092693
2-(2-bromo-4-chlorophenoxy)ethyl 4-(2-amino-2-oxoethoxy)benzoate (PubChem CID 18092693) has the molecular formula C17H15BrClNO5 and a molecular weight of 428.67 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)ethyl 4-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)ethyl 4-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 18092693 |
| Molecular Formula | C17H15BrClNO5 |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)ethyl 4-(2-amino-2-oxoethoxy)benzoate |
| SMILES | NC(=O)COc1ccc(C(=O)OCCOc2ccc(Cl)cc2Br)cc1 |
| InChI | InChI=1S/C17H15BrClNO5/c18-14-9-12(19)3-6-15(14)23-7-8-24-17(22)11-1-4-13(5-2-11)25-10-16(20)21/h1-6,9H,7-8,10H2,(H2,20,21) |
| InChIKey | UYSGIVLNRKNTEG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|