C13H6FN5O3S2 — CID 18095231
2-(4-fluorophenyl)-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,3,4-oxadiazole (PubChem CID 18095231) has the molecular formula C13H6FN5O3S2 and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(4-fluorophenyl)-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 18095231 |
| Molecular Formula | C13H6FN5O3S2 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1c(Sc2nnc(-c3ccc(F)cc3)o2)nc2sccn12 |
| InChI | InChI=1S/C13H6FN5O3S2/c14-8-3-1-7(2-4-8)9-16-17-13(22-9)24-10-11(19(20)21)18-5-6-23-12(18)15-10/h1-6H |
| InChIKey | BSGPRMQNOMWVNH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|