C18H16N4O2S — CID 18095961
2-methyl-6-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 18095961) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-methyl-6-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-6-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 18095961 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-methyl-6-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(Nc3ncnc4sc5c(c34)CCC5)cc2NC1=O |
| InChI | InChI=1S/C18H16N4O2S/c1-9-17(23)22-12-7-10(5-6-13(12)24-9)21-16-15-11-3-2-4-14(11)25-18(15)20-8-19-16/h5-9H,2-4H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | ISZRGIOZJMHJEV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |