C14H25N5O3S — CID 18098771
methyl 2-[[2-(1-tert-butyltetrazol-5-yl)sulfanylacetyl]amino]-3-methylpentanoate (PubChem CID 18098771) has the molecular formula C14H25N5O3S and a molecular weight of 343.45 g/mol. Its IUPAC name is methyl 2-[[2-(1-tert-butyltetrazol-5-yl)sulfanylacetyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[2-(1-tert-butyltetrazol-5-yl)sulfanylacetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 18098771 |
| Molecular Formula | C14H25N5O3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | methyl 2-[[2-(1-tert-butyltetrazol-5-yl)sulfanylacetyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)CSc1nnnn1C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H25N5O3S/c1-7-9(2)11(12(21)22-6)15-10(20)8-23-13-16-17-18-19(13)14(3,4)5/h9,11H,7-8H2,1-6H3,(H,15,20) |
| InChIKey | PECKUEDBECVROF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |