C13H15FN4O2S — CID 18099148
1-(3-fluoro-4-methoxyphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanone (PubChem CID 18099148) has the molecular formula C13H15FN4O2S and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 18099148 |
| Molecular Formula | C13H15FN4O2S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanone |
| SMILES | COc1ccc(C(=O)CSc2nnnn2C(C)C)cc1F |
| InChI | InChI=1S/C13H15FN4O2S/c1-8(2)18-13(15-16-17-18)21-7-11(19)9-4-5-12(20-3)10(14)6-9/h4-6,8H,7H2,1-3H3 |
| InChIKey | ZIRGPAYRIROLDU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |