C19H20N4O7 — CID 18099506
[2-[[3-cyano-4,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 18099506) has the molecular formula C19H20N4O7 and a molecular weight of 416.39 g/mol. Its IUPAC name is [2-[[3-cyano-4,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[[3-cyano-4,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 18099506 |
| Molecular Formula | C19H20N4O7 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [2-[[3-cyano-4,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2ccc([N+](=O)[O-])o2)n(CC2CCCO2)c1C |
| InChI | InChI=1S/C19H20N4O7/c1-11-12(2)22(9-13-4-3-7-28-13)18(14(11)8-20)21-16(24)10-29-19(25)15-5-6-17(30-15)23(26)27/h5-6,13H,3-4,7,9-10H2,1-2H3,(H,21,24) |
| InChIKey | HGJZNDBLRMSKQM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|