C17H16N2O3 — CID 18099535
(6-methylimidazo[1,2-a]pyridin-2-yl)methyl 3-methoxybenzoate (PubChem CID 18099535) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 3-methoxybenzoate.
| Compound Name | (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 3-methoxybenzoate |
|---|---|
| PubChem CID | 18099535 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCc2cn3cc(C)ccc3n2)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-12-6-7-16-18-14(10-19(16)9-12)11-22-17(20)13-4-3-5-15(8-13)21-2/h3-10H,11H2,1-2H3 |
| InChIKey | NHRZWSGIHFSICF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |