C15H15N3O3 — CID 18104064
(5-methyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 18104064) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 18104064 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1nnc(COC(=O)c2ccc3[nH]c(C)c(C)c3c2)o1 |
| InChI | InChI=1S/C15H15N3O3/c1-8-9(2)16-13-5-4-11(6-12(8)13)15(19)20-7-14-18-17-10(3)21-14/h4-6,16H,7H2,1-3H3 |
| InChIKey | OSSFWAHTWAPOCI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|