C17H21N3O5S — CID 18104587
N-[(3-methoxyphenyl)methyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 18104587) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18104587 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cc(S(=O)(=O)N3CCOCC3)c[nH]2)c1 |
| InChI | InChI=1S/C17H21N3O5S/c1-24-14-4-2-3-13(9-14)11-19-17(21)16-10-15(12-18-16)26(22,23)20-5-7-25-8-6-20/h2-4,9-10,12,18H,5-8,11H2,1H3,(H,19,21) |
| InChIKey | CORPCVFHDKOHCF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |