C20H22FNO3 — CID 18104964
N-[2-(4-fluorophenyl)ethyl]-4-(2-methoxy-5-methylphenyl)-4-oxobutanamide (PubChem CID 18104964) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-(2-methoxy-5-methylphenyl)-4-oxobutanamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-(2-methoxy-5-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 18104964 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-(2-methoxy-5-methylphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(C)cc1C(=O)CCC(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO3/c1-14-3-9-19(25-2)17(13-14)18(23)8-10-20(24)22-12-11-15-4-6-16(21)7-5-15/h3-7,9,13H,8,10-12H2,1-2H3,(H,22,24) |
| InChIKey | BQMYEKNVINMXTK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |