C15H20N4OS2 — CID 18105326
1-(3-methylpiperidin-1-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propan-1-one (PubChem CID 18105326) has the molecular formula C15H20N4OS2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 1-(3-methylpiperidin-1-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propan-1-one.
| Compound Name | 1-(3-methylpiperidin-1-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 18105326 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(3-methylpiperidin-1-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propan-1-one |
| SMILES | CC1CCCN(C(=O)CCn2c(-c3cccs3)n[nH]c2=S)C1 |
| InChI | InChI=1S/C15H20N4OS2/c1-11-4-2-7-18(10-11)13(20)6-8-19-14(16-17-15(19)21)12-5-3-9-22-12/h3,5,9,11H,2,4,6-8,10H2,1H3,(H,17,21) |
| InChIKey | LWANPKKRBISJOC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|