C14H17F3N2O3S — CID 18105575
3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 18105575) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 18105575 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C14H17F3N2O3S/c15-14(16,17)10-18-13(20)11-5-4-6-12(9-11)23(21,22)19-7-2-1-3-8-19/h4-6,9H,1-3,7-8,10H2,(H,18,20) |
| InChIKey | HJKYNSOFKRPKBY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |