C12H9F3N2OS — CID 18105647
2-phenyl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide (PubChem CID 18105647) has the molecular formula C12H9F3N2OS and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-phenyl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-phenyl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 18105647 |
| Molecular Formula | C12H9F3N2OS |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-phenyl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H9F3N2OS/c13-12(14,15)7-16-10(18)9-6-19-11(17-9)8-4-2-1-3-5-8/h1-6H,7H2,(H,16,18) |
| InChIKey | AZPJZWMEMUEBGT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |