C14H15F3N2O2S — CID 18105827
3-(2-oxo-1,3-thiazolidin-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 18105827) has the molecular formula C14H15F3N2O2S and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-(2-oxo-1,3-thiazolidin-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(2-oxo-1,3-thiazolidin-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 18105827 |
| Molecular Formula | C14H15F3N2O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-(2-oxo-1,3-thiazolidin-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCN1CCSC1=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2O2S/c15-14(16,17)11-3-1-2-10(8-11)9-18-12(20)4-5-19-6-7-22-13(19)21/h1-3,8H,4-7,9H2,(H,18,20) |
| InChIKey | FPKKZBWBMAXGHO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|