C14H21N5O — CID 18106246
N-butyl-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide (PubChem CID 18106246) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is N-butyl-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide.
| Compound Name | N-butyl-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 18106246 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-butyl-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide |
| SMILES | CCCCNC(=O)CCc1c(C)nc2ncnn2c1C |
| InChI | InChI=1S/C14H21N5O/c1-4-5-8-15-13(20)7-6-12-10(2)18-14-16-9-17-19(14)11(12)3/h9H,4-8H2,1-3H3,(H,15,20) |
| InChIKey | CQPNIAZERRSZKZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|