C17H20N2O3S — CID 18106255
N-butyl-4-(phenylsulfamoyl)benzamide (PubChem CID 18106255) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-butyl-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-butyl-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 18106255 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-butyl-4-(phenylsulfamoyl)benzamide |
| SMILES | CCCCNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-3-13-18-17(20)14-9-11-16(12-10-14)23(21,22)19-15-7-5-4-6-8-15/h4-12,19H,2-3,13H2,1H3,(H,18,20) |
| InChIKey | UEDPUZLUUIRRCO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|