C17H18N2O4S — CID 18109023
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-hydroxy-4-methylphenyl)benzamide (PubChem CID 18109023) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-hydroxy-4-methylphenyl)benzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-hydroxy-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 18109023 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-hydroxy-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCCS3(=O)=O)cc2)c(O)c1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12-3-8-15(16(20)11-12)18-17(21)13-4-6-14(7-5-13)19-9-2-10-24(19,22)23/h3-8,11,20H,2,9-10H2,1H3,(H,18,21) |
| InChIKey | CAYDLJDQMLJZDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|