C18H14FN3O3S — CID 18109267
4-[(4-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzamide (PubChem CID 18109267) has the molecular formula C18H14FN3O3S and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 18109267 |
| Molecular Formula | C18H14FN3O3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzamide |
| SMILES | O=C(Nc1ccncc1)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H14FN3O3S/c19-14-3-7-17(8-4-14)26(24,25)22-16-5-1-13(2-6-16)18(23)21-15-9-11-20-12-10-15/h1-12,22H,(H,20,21,23) |
| InChIKey | ACJWLJAMOSWTJV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |