C20H17N3O4S — CID 18111303
4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-[2-(furan-2-yl)ethyl]benzamide (PubChem CID 18111303) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-[2-(furan-2-yl)ethyl]benzamide.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-[2-(furan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 18111303 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-[2-(furan-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccco1)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c24-20(21-12-11-16-4-3-13-27-16)14-7-9-15(10-8-14)22-19-17-5-1-2-6-18(17)28(25,26)23-19/h1-10,13H,11-12H2,(H,21,24)(H,22,23) |
| InChIKey | FDVBHDCQZYFIDZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |