C17H14BrN3O2 — CID 18111460
N-[(4-bromophenyl)methyl]-N-methyl-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 18111460) has the molecular formula C17H14BrN3O2 and a molecular weight of 372.22 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-methyl-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N-methyl-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 18111460 |
| Molecular Formula | C17H14BrN3O2 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-methyl-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CN(Cc1ccc(Br)cc1)C(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H14BrN3O2/c1-21(10-11-6-8-12(18)9-7-11)17(23)15-13-4-2-3-5-14(13)16(22)20-19-15/h2-9H,10H2,1H3,(H,20,22) |
| InChIKey | RWCGUDYHFKMOKW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |