C21H25ClN2O4S — CID 18112539
4-[(4-acetylphenyl)sulfonyl-methylamino]-N-[(3-chlorophenyl)methyl]-N-methylbutanamide (PubChem CID 18112539) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-[(3-chlorophenyl)methyl]-N-methylbutanamide.
| Compound Name | 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-[(3-chlorophenyl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 18112539 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-[(3-chlorophenyl)methyl]-N-methylbutanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CCCC(=O)N(C)Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H25ClN2O4S/c1-16(25)18-9-11-20(12-10-18)29(27,28)24(3)13-5-8-21(26)23(2)15-17-6-4-7-19(22)14-17/h4,6-7,9-12,14H,5,8,13,15H2,1-3H3 |
| InChIKey | RTLCWFFDYJBQFD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |