C17H18ClNO3 — CID 18112540
N-[(3-chlorophenyl)methyl]-2,5-dimethoxy-N-methylbenzamide (PubChem CID 18112540) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2,5-dimethoxy-N-methylbenzamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 18112540 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2,5-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(OC)c(C(=O)N(C)Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H18ClNO3/c1-19(11-12-5-4-6-13(18)9-12)17(20)15-10-14(21-2)7-8-16(15)22-3/h4-10H,11H2,1-3H3 |
| InChIKey | VTCJQXRDMVLCOU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |