C13H13F2N3O — CID 18112634
N-[1-(3,4-difluorophenyl)ethyl]-1-methylpyrazole-4-carboxamide (PubChem CID 18112634) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18112634 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cnn(C)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H13F2N3O/c1-8(9-3-4-11(14)12(15)5-9)17-13(19)10-6-16-18(2)7-10/h3-8H,1-2H3,(H,17,19) |
| InChIKey | RXSYVEUZQKZVRH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |