C21H19ClN2O4 — CID 18112982
N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-N-ethyl-2-oxochromene-3-carboxamide (PubChem CID 18112982) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-N-ethyl-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-N-ethyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 18112982 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-N-ethyl-2-oxochromene-3-carboxamide |
| SMILES | CCN(CC(=O)Nc1cc(Cl)ccc1C)C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H19ClN2O4/c1-3-24(12-19(25)23-17-11-15(22)9-8-13(17)2)20(26)16-10-14-6-4-5-7-18(14)28-21(16)27/h4-11H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | PFULQCHOLWXFSJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|