C20H27NO2S2 — CID 18115632
N-[2-(3-methylphenoxy)ethyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide (PubChem CID 18115632) has the molecular formula C20H27NO2S2 and a molecular weight of 377.58 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide |
|---|---|
| PubChem CID | 18115632 |
| Molecular Formula | C20H27NO2S2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide |
| SMILES | Cc1cccc(OCCNC(=O)C2CC3CCC(C2)C32SCCS2)c1 |
| InChI | InChI=1S/C20H27NO2S2/c1-14-3-2-4-18(11-14)23-8-7-21-19(22)15-12-16-5-6-17(13-15)20(16)24-9-10-25-20/h2-4,11,15-17H,5-10,12-13H2,1H3,(H,21,22) |
| InChIKey | QOIZMLOLWDCCHE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|