C16H20F2N4O2S — CID 18116818
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 18116818) has the molecular formula C16H20F2N4O2S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18116818 |
| Molecular Formula | C16H20F2N4O2S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H20F2N4O2S/c1-2-3-13-20-21-16(25)22(13)10-14(23)19-9-8-11-4-6-12(7-5-11)24-15(17)18/h4-7,15H,2-3,8-10H2,1H3,(H,19,23)(H,21,25) |
| InChIKey | VZMNYVKQIVDXSY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|